C22H43NO10P+ — CID 78225766
[(2S)-2-amino-2-carboxyethoxy]-[(2R)-2,3-di(octanoyloxy)propoxy]-dihydroxyphosphanium (PubChem CID 78225766) has the molecular formula C22H43NO10P+ and a molecular weight of 512.56 g/mol. Its IUPAC name is [(2S)-2-amino-2-carboxyethoxy]-[(2R)-2,3-di(octanoyloxy)propoxy]-dihydroxyphosphanium.
| Compound Name | [(2S)-2-amino-2-carboxyethoxy]-[(2R)-2,3-di(octanoyloxy)propoxy]-dihydroxyphosphanium |
|---|---|
| PubChem CID | 78225766 |
| Molecular Formula | C22H43NO10P+ |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | [(2S)-2-amino-2-carboxyethoxy]-[(2R)-2,3-di(octanoyloxy)propoxy]-dihydroxyphosphanium |
| SMILES | CCCCCCCC(=O)OC[C@H](CO[P+](O)(O)OC[C@H](N)C(=O)O)OC(=O)CCCCCCC |
| InChI | InChI=1S/C22H42NO10P/c1-3-5-7-9-11-13-20(24)30-15-18(33-21(25)14-12-10-8-6-4-2)16-31-34(28,29)32-17-19(23)22(26)27/h18-19,28-29H,3-17,23H2,1-2H3/p+1/t18-,19+/m1/s1 |
| InChIKey | HQKLGFWGHZSVCF-MOPGFXCFSA-O |
| XLogP | 3.27 |
| TPSA | 174.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|