C15H28N4O4 — CID 78225911
(3R,4R,5S)-4-acetamido-5-(diaminomethylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid (PubChem CID 78225911) has the molecular formula C15H28N4O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is (3R,4R,5S)-4-acetamido-5-(diaminomethylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid.
| Compound Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 78225911 |
| Molecular Formula | C15H28N4O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | (3R,4R,5S)-4-acetamido-5-(diaminomethylamino)-3-pentan-3-yloxycyclohexene-1-carboxylic acid |
| SMILES | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NC(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C15H28N4O4/c1-4-10(5-2)23-12-7-9(14(21)22)6-11(19-15(16)17)13(12)18-8(3)20/h7,10-13,15,19H,4-6,16-17H2,1-3H3,(H,18,20)(H,21,22)/t11-,12+,13+/m0/s1 |
| InChIKey | OIZHRQCVFSCVMA-YNEHKIRRSA-N |
| XLogP | -0.36 |
| TPSA | 139.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|