C6H11FO5 — CID 78226014
(2S,3S,4R,5S)-2-fluoro-2-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 78226014) has the molecular formula C6H11FO5 and a molecular weight of 182.15 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-fluoro-2-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S)-2-fluoro-2-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 78226014 |
| Molecular Formula | C6H11FO5 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (2S,3S,4R,5S)-2-fluoro-2-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@@]1(F)OC[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H11FO5/c7-6(2-8)5(11)4(10)3(9)1-12-6/h3-5,8-11H,1-2H2/t3-,4+,5-,6+/m0/s1 |
| InChIKey | JZYFGOJLDZEICM-BGPJRJDNSA-N |
| XLogP | -2.24 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |