C24H24FN5O2 — CID 78227757
6-amino-1'-[(3-fluorophenyl)methyl]-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile (PubChem CID 78227757) has the molecular formula C24H24FN5O2 and a molecular weight of 433.49 g/mol. Its IUPAC name is 6-amino-1'-[(3-fluorophenyl)methyl]-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile.
| Compound Name | 6-amino-1'-[(3-fluorophenyl)methyl]-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
|---|---|
| PubChem CID | 78227757 |
| Molecular Formula | C24H24FN5O2 |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 6-amino-1'-[(3-fluorophenyl)methyl]-2'-oxo-3-propylspiro[2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole-4,3'-indole]-5-carbonitrile |
| SMILES | CCCC1NNC2OC(N)=C(C#N)C3(C(=O)N(Cc4cccc(F)c4)c4ccccc43)C12 |
| InChI | InChI=1S/C24H24FN5O2/c1-2-6-18-20-22(29-28-18)32-21(27)17(12-26)24(20)16-9-3-4-10-19(16)30(23(24)31)13-14-7-5-8-15(25)11-14/h3-5,7-11,18,20,22,28-29H,2,6,13,27H2,1H3 |
| InChIKey | IRLOZFSINIMSMN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |