C22H27NO6 — CID 78228223
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78228223) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78228223 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-hydroxy-8-(morpholin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccc3c(c2)OCCO3)=COC2C1CCC(O)C2CN1CCOCC1 |
| InChI | InChI=1S/C22H27NO6/c24-18-3-2-15-21(25)17(14-1-4-19-20(11-14)28-10-9-27-19)13-29-22(15)16(18)12-23-5-7-26-8-6-23/h1,4,11,13,15-16,18,22,24H,2-3,5-10,12H2 |
| InChIKey | RDVNPXVTKNDJOG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |