C17H18ClNO5S — CID 7822854
(6-chloro-4H-1,3-benzodioxin-8-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7822854) has the molecular formula C17H18ClNO5S and a molecular weight of 383.85 g/mol. Its IUPAC name is (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7822854 |
| Molecular Formula | C17H18ClNO5S |
| Molecular Weight | 383.85 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | (6-chloro-4H-1,3-benzodioxin-8-yl)methyl (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)OCc1cc(Cl)cc3c1OCOC3)CS2 |
| InChI | InChI=1S/C17H18ClNO5S/c1-17-3-2-14(20)19(17)13(8-25-17)16(21)23-7-11-5-12(18)4-10-6-22-9-24-15(10)11/h4-5,13H,2-3,6-9H2,1H3/t13-,17+/m0/s1 |
| InChIKey | QTTZGKAWLSDVJH-SUMWQHHRSA-N |
| XLogP | 2.70 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |