C23H22O4 — CID 78236693
7-phenacyloxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78236693) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 7-phenacyloxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-phenacyloxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78236693 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 7-phenacyloxy-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C(COC1CCC2C(=O)C(c3ccccc3)=COC2C1)c1ccccc1 |
| InChI | InChI=1S/C23H22O4/c24-21(17-9-5-2-6-10-17)15-26-18-11-12-19-22(13-18)27-14-20(23(19)25)16-7-3-1-4-8-16/h1-10,14,18-19,22H,11-13,15H2 |
| InChIKey | HGLCWUCZJJUJOC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |