C24H23ClO5 — CID 78237792
[3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-chlorobenzoate (PubChem CID 78237792) has the molecular formula C24H23ClO5 and a molecular weight of 426.90 g/mol. Its IUPAC name is [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-chlorobenzoate.
| Compound Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 78237792 |
| Molecular Formula | C24H23ClO5 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [3-(2,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-chlorobenzoate |
| SMILES | Cc1ccc(C)c(OC2=COC3CC(OC(=O)c4ccccc4Cl)CCC3C2=O)c1 |
| InChI | InChI=1S/C24H23ClO5/c1-14-7-8-15(2)20(11-14)30-22-13-28-21-12-16(9-10-18(21)23(22)26)29-24(27)17-5-3-4-6-19(17)25/h3-8,11,13,16,18,21H,9-10,12H2,1-2H3 |
| InChIKey | GNKWRNUBCGLANR-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |