C18H19ClO4 — CID 78237821
3-(2-chlorophenoxy)-7-prop-2-enoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78237821) has the molecular formula C18H19ClO4 and a molecular weight of 334.80 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-7-prop-2-enoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(2-chlorophenoxy)-7-prop-2-enoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78237821 |
| Molecular Formula | C18H19ClO4 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 3-(2-chlorophenoxy)-7-prop-2-enoxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | C=CCOC1CCC2C(=O)C(Oc3ccccc3Cl)=COC2C1 |
| InChI | InChI=1S/C18H19ClO4/c1-2-9-21-12-7-8-13-16(10-12)22-11-17(18(13)20)23-15-6-4-3-5-14(15)19/h2-6,11-13,16H,1,7-10H2 |
| InChIKey | QZYVYKGIXKWNRL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|