C21H27ClO4 — CID 78237827
7-butoxy-3-(4-chloro-3,5-dimethylphenoxy)-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78237827) has the molecular formula C21H27ClO4 and a molecular weight of 378.90 g/mol. Its IUPAC name is 7-butoxy-3-(4-chloro-3,5-dimethylphenoxy)-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-butoxy-3-(4-chloro-3,5-dimethylphenoxy)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78237827 |
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 7-butoxy-3-(4-chloro-3,5-dimethylphenoxy)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | CCCCOC1CCC2C(=O)C(Oc3cc(C)c(Cl)c(C)c3)=COC2C1 |
| InChI | InChI=1S/C21H27ClO4/c1-4-5-8-24-15-6-7-17-18(11-15)25-12-19(21(17)23)26-16-9-13(2)20(22)14(3)10-16/h9-10,12,15,17-18H,4-8,11H2,1-3H3 |
| InChIKey | RPRXVXQQYOCLAY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|