C14H21N — CID 7823786
(4S)-6-ethyl-2,2,4-trimethyl-3,4-dihydro-1H-quinoline (PubChem CID 7823786) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (4S)-6-ethyl-2,2,4-trimethyl-3,4-dihydro-1H-quinoline.
| Compound Name | (4S)-6-ethyl-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 7823786 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (4S)-6-ethyl-2,2,4-trimethyl-3,4-dihydro-1H-quinoline |
| SMILES | CCc1ccc2c(c1)[C@@H](C)CC(C)(C)N2 |
| InChI | InChI=1S/C14H21N/c1-5-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-8,10,15H,5,9H2,1-4H3/t10-/m0/s1 |
| InChIKey | HZACWRNMJMRXAI-JTQLQIEISA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |