C24H22BrClO5 — CID 78237913
[3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-bromobenzoate (PubChem CID 78237913) has the molecular formula C24H22BrClO5 and a molecular weight of 505.79 g/mol. Its IUPAC name is [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-bromobenzoate.
| Compound Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-bromobenzoate |
|---|---|
| PubChem CID | 78237913 |
| Molecular Formula | C24H22BrClO5 |
| Molecular Weight | 505.79 g/mol |
| Exact Mass | 504.03 |
| IUPAC Name | [3-(4-chloro-3,5-dimethylphenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 2-bromobenzoate |
| SMILES | Cc1cc(OC2=COC3CC(OC(=O)c4ccccc4Br)CCC3C2=O)cc(C)c1Cl |
| InChI | InChI=1S/C24H22BrClO5/c1-13-9-16(10-14(2)22(13)26)30-21-12-29-20-11-15(7-8-18(20)23(21)27)31-24(28)17-5-3-4-6-19(17)25/h3-6,9-10,12,15,18,20H,7-8,11H2,1-2H3 |
| InChIKey | XNNIUWLWYIKNCX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.79 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |