About 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 7824132) has the molecular formula C14H12F3N3O4
and a molecular weight of 343.26 g/mol. Its IUPAC name is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
Molecular Properties
| Compound Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| PubChem CID | 7824132 |
| Molecular Formula | C14H12F3N3O4 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN1C(=O)C(=O)N(CC(=O)Nc2cccc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C14H12F3N3O4/c1-2-19-11(22)12(23)20(13(19)24)7-10(21)18-9-5-3-4-8(6-9)14(15,16)17/h3-6H,2,7H2,1H3,(H,18,21) |
| InChIKey | AMOBNOVMAGLECB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide?
The IUPAC name of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (CID 7824132) is 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
What is the SMILES notation for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide?
The canonical SMILES for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide is CCN1C(=O)C(=O)N(CC(=O)Nc2cccc(C(F)(F)F)c2)C1=O.
What is the InChIKey of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide?
The InChIKey is AMOBNOVMAGLECB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12F3N3O4/c1-2-19-11(22)12(23)20(13(19)24)7-10(21)18-9-5-3-4-8(6-9)14(15,16)17/h3-6H,2,7H2,1H3,(H,18,21).
What are the key properties of 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide?
2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide has a molecular weight of 343.26 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-2,4,5-trioxoimidazolidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide is sourced from PubChem (CID 7824132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).