About (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine
(2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine (PubChem CID 782417) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine.
Molecular Properties
| Compound Name | (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine |
| PubChem CID | 782417 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine |
| SMILES | C=C(C)[C@@H]1CC=C(CN2C[C@@H](C)O[C@H](C)C2)CC1 |
| InChI | InChI=1S/C16H27NO/c1-12(2)16-7-5-15(6-8-16)11-17-9-13(3)18-14(4)10-17/h5,13-14,16H,1,6-11H2,2-4H3/t13-,14-,16-/m1/s1 |
| InChIKey | HABGVALJRPPCLM-IIAWOOMASA-N |
| XLogP | 3.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine?
The IUPAC name of (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine (CID 782417) is (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine.
What is the SMILES notation for (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine?
The canonical SMILES for (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine is C=C(C)[C@@H]1CC=C(CN2C[C@@H](C)O[C@H](C)C2)CC1.
What is the InChIKey of (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine?
The InChIKey is HABGVALJRPPCLM-IIAWOOMASA-N. The full InChI is InChI=1S/C16H27NO/c1-12(2)16-7-5-15(6-8-16)11-17-9-13(3)18-14(4)10-17/h5,13-14,16H,1,6-11H2,2-4H3/t13-,14-,16-/m1/s1.
What are the key properties of (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine?
(2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine has a molecular weight of 249.40 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,6R)-2,6-dimethyl-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methyl]morpholine is sourced from PubChem (CID 782417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).