C25H24O6 — CID 78246292
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-phenacyloxy-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 78246292) has the molecular formula C25H24O6 and a molecular weight of 420.46 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-phenacyloxy-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-phenacyloxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 78246292 |
| Molecular Formula | C25H24O6 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-7-phenacyloxy-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C(COC1CCC2C(=O)C(c3ccc4c(c3)OCCO4)=COC2C1)c1ccccc1 |
| InChI | InChI=1S/C25H24O6/c26-21(16-4-2-1-3-5-16)15-30-18-7-8-19-23(13-18)31-14-20(25(19)27)17-6-9-22-24(12-17)29-11-10-28-22/h1-6,9,12,14,18-19,23H,7-8,10-11,13,15H2 |
| InChIKey | PZKXPLBSSPCOFQ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |