C25H24FNO4 — CID 78248988
1-(4-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78248988) has the molecular formula C25H24FNO4 and a molecular weight of 421.47 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78248988 |
| Molecular Formula | C25H24FNO4 |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 1-(4-fluorophenyl)-2-[(4-methoxyphenyl)methyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(CN2C(=O)C3=C(C(=O)C4CCCCC4O3)C2c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H24FNO4/c1-30-18-12-6-15(7-13-18)14-27-22(16-8-10-17(26)11-9-16)21-23(28)19-4-2-3-5-20(19)31-24(21)25(27)29/h6-13,19-20,22H,2-5,14H2,1H3 |
| InChIKey | HLAXPAZWRWHBGI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |