C16H17BrO5S — CID 78254325
[3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methanesulfonate (PubChem CID 78254325) has the molecular formula C16H17BrO5S and a molecular weight of 401.28 g/mol. Its IUPAC name is [3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methanesulfonate.
| Compound Name | [3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 78254325 |
| Molecular Formula | C16H17BrO5S |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.00 |
| IUPAC Name | [3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCC2C(=O)C(c3ccc(Br)cc3)=COC2C1 |
| InChI | InChI=1S/C16H17BrO5S/c1-23(19,20)22-12-6-7-13-15(8-12)21-9-14(16(13)18)10-2-4-11(17)5-3-10/h2-5,9,12-13,15H,6-8H2,1H3 |
| InChIKey | BAWDVZUTSJBJPI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|