C22H18ClFN2O3 — CID 78255077
2-(5-chloro-2-pyridinyl)-1-(2-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78255077) has the molecular formula C22H18ClFN2O3 and a molecular weight of 412.85 g/mol. Its IUPAC name is 2-(5-chloro-2-pyridinyl)-1-(2-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(5-chloro-2-pyridinyl)-1-(2-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78255077 |
| Molecular Formula | C22H18ClFN2O3 |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-(5-chloro-2-pyridinyl)-1-(2-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1C2=C(OC3CCCCC13)C(=O)N(c1ccc(Cl)cn1)C2c1ccccc1F |
| InChI | InChI=1S/C22H18ClFN2O3/c23-12-9-10-17(25-11-12)26-19(13-5-1-3-7-15(13)24)18-20(27)14-6-2-4-8-16(14)29-21(18)22(26)28/h1,3,5,7,9-11,14,16,19H,2,4,6,8H2 |
| InChIKey | HGFYLSLWTKMCAG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |