C23H22N3O6S+ — CID 78260792
3-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-3-yl]-N-(furan-2-ylmethyl)propanamide (PubChem CID 78260792) has the molecular formula C23H22N3O6S+ and a molecular weight of 468.51 g/mol. Its IUPAC name is 3-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-3-yl]-N-(furan-2-ylmethyl)propanamide.
| Compound Name | 3-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-3-yl]-N-(furan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 78260792 |
| Molecular Formula | C23H22N3O6S+ |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 3-[1-[(5-formyl-2-methoxyphenyl)methyl]-2,4-dioxo-4aH-thieno[3,2-d]pyrimidin-1-ium-3-yl]-N-(furan-2-ylmethyl)propanamide |
| SMILES | COc1ccc(C=O)cc1C[N+]1=C2C=CSC2C(=O)N(CCC(=O)NCc2ccco2)C1=O |
| InChI | InChI=1S/C23H21N3O6S/c1-31-19-5-4-15(14-27)11-16(19)13-26-18-7-10-33-21(18)22(29)25(23(26)30)8-6-20(28)24-12-17-3-2-9-32-17/h2-5,7,9-11,14,21H,6,8,12-13H2,1H3/p+1 |
| InChIKey | ZZRSDDLFAQBZTI-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 108.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|