C18H25NO5S — CID 78261058
6-ethoxy-3-(4-methoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one (PubChem CID 78261058) has the molecular formula C18H25NO5S and a molecular weight of 367.47 g/mol. Its IUPAC name is 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one.
| Compound Name | 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 78261058 |
| Molecular Formula | C18H25NO5S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 6-ethoxy-3-(4-methoxyphenyl)sulfonyl-2,3,4a,5,6,7,8,8a-octahydro-1H-quinolin-4-one |
| SMILES | CCOC1CCC2NCC(S(=O)(=O)c3ccc(OC)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C18H25NO5S/c1-3-24-13-6-9-16-15(10-13)18(20)17(11-19-16)25(21,22)14-7-4-12(23-2)5-8-14/h4-5,7-8,13,15-17,19H,3,6,9-11H2,1-2H3 |
| InChIKey | OAVQHCJZCKKLRQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |