C23H28N4OS+2 — CID 7826395
10-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one (PubChem CID 7826395) has the molecular formula C23H28N4OS+2 and a molecular weight of 408.57 g/mol. Its IUPAC name is 10-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one.
| Compound Name | 10-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
|---|---|
| PubChem CID | 7826395 |
| Molecular Formula | C23H28N4OS+2 |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 10-[[4-[(E)-3-phenylprop-2-enyl]piperazine-1,4-diium-1-yl]methyl]-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9-trien-12-one |
| SMILES | O=c1[nH]c(C[NH+]2CC[NH+](C/C=C/c3ccccc3)CC2)nc2sc3c(c12)CCC3 |
| InChI | InChI=1S/C23H26N4OS/c28-22-21-18-9-4-10-19(18)29-23(21)25-20(24-22)16-27-14-12-26(13-15-27)11-5-8-17-6-2-1-3-7-17/h1-3,5-8H,4,9-16H2,(H,24,25,28)/p+2/b8-5+ |
| InChIKey | UNSQGRVVJWCYQE-VMPITWQZSA-P |
| XLogP | 0.47 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |