C12H6F8N2O — CID 78265464
3-(1,1,2,2,3,3,4,4-octafluorobutyl)-3H-quinoxalin-2-one (PubChem CID 78265464) has the molecular formula C12H6F8N2O and a molecular weight of 346.18 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-3H-quinoxalin-2-one.
| Compound Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 78265464 |
| Molecular Formula | C12H6F8N2O |
| Molecular Weight | 346.18 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4-octafluorobutyl)-3H-quinoxalin-2-one |
| SMILES | O=C1N=c2ccccc2=NC1C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H6F8N2O/c13-9(14)11(17,18)12(19,20)10(15,16)7-8(23)22-6-4-2-1-3-5(6)21-7/h1-4,7,9H |
| InChIKey | HOOWPTMIJIEYQF-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|