C15H17NO7S — CID 7826770
ethyl 2-[(3R,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate (PubChem CID 7826770) has the molecular formula C15H17NO7S and a molecular weight of 355.37 g/mol. Its IUPAC name is ethyl 2-[(3R,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3R,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 7826770 |
| Molecular Formula | C15H17NO7S |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | ethyl 2-[(3R,4R)-3,4-diacetyloxy-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C2=C[C@@H](OC(C)=O)[C@H](OC(C)=O)CO2)n1 |
| InChI | InChI=1S/C15H17NO7S/c1-4-20-15(19)10-7-24-14(16-10)12-5-11(22-8(2)17)13(6-21-12)23-9(3)18/h5,7,11,13H,4,6H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | PVVMXTGQKPELSR-DGCLKSJQSA-N |
| XLogP | 1.55 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|