About 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium
2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium (PubChem CID 7826989) has the molecular formula C6H12N3OS+
and a molecular weight of 174.25 g/mol. Its IUPAC name is 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium.
Molecular Properties
| Compound Name | 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium |
| PubChem CID | 7826989 |
| Molecular Formula | C6H12N3OS+ |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium |
| SMILES | CCSc1nnc(CC[NH3+])o1 |
| InChI | InChI=1S/C6H11N3OS/c1-2-11-6-9-8-5(10-6)3-4-7/h2-4,7H2,1H3/p+1 |
| InChIKey | CLORERDCHQSTNU-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium?
The IUPAC name of 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium (CID 7826989) is 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium.
What is the SMILES notation for 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium?
The canonical SMILES for 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium is CCSc1nnc(CC[NH3+])o1.
What is the InChIKey of 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium?
The InChIKey is CLORERDCHQSTNU-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H11N3OS/c1-2-11-6-9-8-5(10-6)3-4-7/h2-4,7H2,1H3/p+1.
What are the key properties of 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium?
2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium has a molecular weight of 174.25 g/mol, XLogP of -0.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethylsulfanyl-1,3,4-oxadiazol-2-yl)ethylazanium is sourced from PubChem (CID 7826989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).