About 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one
5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one (PubChem CID 78272115) has the molecular formula C9H10N2OS2
and a molecular weight of 226.33 g/mol. Its IUPAC name is 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one |
| PubChem CID | 78272115 |
| Molecular Formula | C9H10N2OS2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CC1=C(C)C2C(=O)N=C(CS)N=C2S1 |
| InChI | InChI=1S/C9H10N2OS2/c1-4-5(2)14-9-7(4)8(12)10-6(3-13)11-9/h7,13H,3H2,1-2H3 |
| InChIKey | BSUDIUSQJIRSLQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 41.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one?
The IUPAC name of 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one (CID 78272115) is 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one.
What is the SMILES notation for 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one?
The canonical SMILES for 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one is CC1=C(C)C2C(=O)N=C(CS)N=C2S1.
What is the InChIKey of 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one?
The InChIKey is BSUDIUSQJIRSLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2OS2/c1-4-5(2)14-9-7(4)8(12)10-6(3-13)11-9/h7,13H,3H2,1-2H3.
What are the key properties of 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one?
5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one has a molecular weight of 226.33 g/mol, XLogP of 1.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2-(sulfanylmethyl)-4aH-thieno[2,3-d]pyrimidin-4-one is sourced from PubChem (CID 78272115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).