About 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide
2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (PubChem CID 782771) has the molecular formula C15H12N2O3S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| PubChem CID | 782771 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccccc3O)sc2c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-20-9-6-7-11-13(8-9)21-15(16-11)17-14(19)10-4-2-3-5-12(10)18/h2-8,18H,1H3,(H,16,17,19) |
| InChIKey | KVPJVNVLBXIDIP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide?
The IUPAC name of 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide (CID 782771) is 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide.
What is the SMILES notation for 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide?
The canonical SMILES for 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide is COc1ccc2nc(NC(=O)c3ccccc3O)sc2c1.
What is the InChIKey of 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide?
The InChIKey is KVPJVNVLBXIDIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3S/c1-20-9-6-7-11-13(8-9)21-15(16-11)17-14(19)10-4-2-3-5-12(10)18/h2-8,18H,1H3,(H,16,17,19).
What are the key properties of 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide?
2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide has a molecular weight of 300.34 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N-(6-methoxy-1,3-benzothiazol-2-yl)benzamide is sourced from PubChem (CID 782771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).