C19H28N2O5S — CID 7828322
[2-(cyclohexylamino)-2-oxoethyl] 4-[[(2S)-butan-2-yl]sulfamoyl]benzoate (PubChem CID 7828322) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is [2-(cyclohexylamino)-2-oxoethyl] 4-[[(2S)-butan-2-yl]sulfamoyl]benzoate.
| Compound Name | [2-(cyclohexylamino)-2-oxoethyl] 4-[[(2S)-butan-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 7828322 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(cyclohexylamino)-2-oxoethyl] 4-[[(2S)-butan-2-yl]sulfamoyl]benzoate |
| SMILES | CC[C@H](C)NS(=O)(=O)c1ccc(C(=O)OCC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C19H28N2O5S/c1-3-14(2)21-27(24,25)17-11-9-15(10-12-17)19(23)26-13-18(22)20-16-7-5-4-6-8-16/h9-12,14,16,21H,3-8,13H2,1-2H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | BLYPMWYKPRCVKR-AWEZNQCLSA-N |
| XLogP | 2.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |