C20H22N2O5S — CID 7828591
(2S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 7828591) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is (2S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 7828591 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (2S)-2-[[2-[(4-methoxybenzoyl)amino]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | COc1ccc(C(=O)Nc2ccccc2C(=O)N[C@@H](CCSC)C(=O)O)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c1-27-14-9-7-13(8-10-14)18(23)21-16-6-4-3-5-15(16)19(24)22-17(20(25)26)11-12-28-2/h3-10,17H,11-12H2,1-2H3,(H,21,23)(H,22,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | PHBZWWGZALZZGN-KRWDZBQOSA-N |
| XLogP | 2.88 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |