C19H29ClN2 — CID 782883
1-(4-chlorophenyl)-4-[(2S)-2,6-dimethylhept-5-enyl]piperazine (PubChem CID 782883) has the molecular formula C19H29ClN2 and a molecular weight of 320.91 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-4-[(2S)-2,6-dimethylhept-5-enyl]piperazine.
| Compound Name | 1-(4-chlorophenyl)-4-[(2S)-2,6-dimethylhept-5-enyl]piperazine |
|---|---|
| PubChem CID | 782883 |
| Molecular Formula | C19H29ClN2 |
| Molecular Weight | 320.91 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-(4-chlorophenyl)-4-[(2S)-2,6-dimethylhept-5-enyl]piperazine |
| SMILES | CC(C)=CCC[C@H](C)CN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H29ClN2/c1-16(2)5-4-6-17(3)15-21-11-13-22(14-12-21)19-9-7-18(20)8-10-19/h5,7-10,17H,4,6,11-15H2,1-3H3/t17-/m0/s1 |
| InChIKey | MWPBWJAWYBHWPP-KRWDZBQOSA-N |
| XLogP | 4.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.91 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|