C20H24N2O4S — CID 78288616
3-(furan-2-yl)-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 78288616) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 3-(furan-2-yl)-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(furan-2-yl)-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 78288616 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-(furan-2-yl)-1-[4-(4-propan-2-ylphenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | CC(C)c1ccc(S(=O)(=O)N2CCN(C(=O)C=Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C20H24N2O4S/c1-16(2)17-5-8-19(9-6-17)27(24,25)22-13-11-21(12-14-22)20(23)10-7-18-4-3-15-26-18/h3-10,15-16H,11-14H2,1-2H3 |
| InChIKey | HPXBZTGABALVPW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|