About 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate
6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate (PubChem CID 78292337) has the molecular formula C5H10BrN3O3
and a molecular weight of 240.06 g/mol. Its IUPAC name is 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate.
Molecular Properties
| Compound Name | 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate |
| PubChem CID | 78292337 |
| Molecular Formula | C5H10BrN3O3 |
| Molecular Weight | 240.06 g/mol |
| Exact Mass | 238.99 |
| IUPAC Name | 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate |
| SMILES | CN1C(=O)NC(=O)C(Br)C1N.O |
| InChI | InChI=1S/C5H8BrN3O2.H2O/c1-9-3(7)2(6)4(10)8-5(9)11;/h2-3H,7H2,1H3,(H,8,10,11);1H2 |
| InChIKey | NQBIWRVKWROZRI-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.06 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate?
The IUPAC name of 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate (CID 78292337) is 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate.
What is the SMILES notation for 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate?
The canonical SMILES for 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate is CN1C(=O)NC(=O)C(Br)C1N.O.
What is the InChIKey of 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate?
The InChIKey is NQBIWRVKWROZRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8BrN3O2.H2O/c1-9-3(7)2(6)4(10)8-5(9)11;/h2-3H,7H2,1H3,(H,8,10,11);1H2.
What are the key properties of 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate?
6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate has a molecular weight of 240.06 g/mol, XLogP of -1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-bromo-1-methyl-1,3-diazinane-2,4-dione;hydrate is sourced from PubChem (CID 78292337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).