About 2-bromo-2H-pyrazin-5-one
2-bromo-2H-pyrazin-5-one (PubChem CID 78292344) has the molecular formula C4H3BrN2O
and a molecular weight of 174.99 g/mol. Its IUPAC name is 2-bromo-2H-pyrazin-5-one.
Molecular Properties
| Compound Name | 2-bromo-2H-pyrazin-5-one |
| PubChem CID | 78292344 |
| Molecular Formula | C4H3BrN2O |
| Molecular Weight | 174.99 g/mol |
| Exact Mass | 173.94 |
| IUPAC Name | 2-bromo-2H-pyrazin-5-one |
| SMILES | O=C1C=NC(Br)C=N1 |
| InChI | InChI=1S/C4H3BrN2O/c5-3-1-7-4(8)2-6-3/h1-3H |
| InChIKey | YTQYYWAUPNRXTM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.99 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-2H-pyrazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-2H-pyrazin-5-one?
The IUPAC name of 2-bromo-2H-pyrazin-5-one (CID 78292344) is 2-bromo-2H-pyrazin-5-one.
What is the SMILES notation for 2-bromo-2H-pyrazin-5-one?
The canonical SMILES for 2-bromo-2H-pyrazin-5-one is O=C1C=NC(Br)C=N1.
What is the InChIKey of 2-bromo-2H-pyrazin-5-one?
The InChIKey is YTQYYWAUPNRXTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3BrN2O/c5-3-1-7-4(8)2-6-3/h1-3H.
What are the key properties of 2-bromo-2H-pyrazin-5-one?
2-bromo-2H-pyrazin-5-one has a molecular weight of 174.99 g/mol, XLogP of 0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-2H-pyrazin-5-one is sourced from PubChem (CID 78292344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).