C24H23ClO7 — CID 78293264
[3-(2-chlorophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,5-dimethoxybenzoate (PubChem CID 78293264) has the molecular formula C24H23ClO7 and a molecular weight of 458.89 g/mol. Its IUPAC name is [3-(2-chlorophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,5-dimethoxybenzoate.
| Compound Name | [3-(2-chlorophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 78293264 |
| Molecular Formula | C24H23ClO7 |
| Molecular Weight | 458.89 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [3-(2-chlorophenoxy)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)OC2CCC3C(=O)C(Oc4ccccc4Cl)=COC3C2)c1 |
| InChI | InChI=1S/C24H23ClO7/c1-28-16-9-14(10-17(11-16)29-2)24(27)31-15-7-8-18-21(12-15)30-13-22(23(18)26)32-20-6-4-3-5-19(20)25/h3-6,9-11,13,15,18,21H,7-8,12H2,1-2H3 |
| InChIKey | JRACEXFCVQWGKA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |