C15H18N4O2S — CID 78295879
3-methyl-8-phenylsulfanyl-7-propyl-4,5-dihydropurine-2,6-dione (PubChem CID 78295879) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 3-methyl-8-phenylsulfanyl-7-propyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 3-methyl-8-phenylsulfanyl-7-propyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78295879 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 3-methyl-8-phenylsulfanyl-7-propyl-4,5-dihydropurine-2,6-dione |
| SMILES | CCCN1C(Sc2ccccc2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C15H18N4O2S/c1-3-9-19-11-12(18(2)14(21)17-13(11)20)16-15(19)22-10-7-5-4-6-8-10/h4-8,11-12H,3,9H2,1-2H3,(H,17,20,21) |
| InChIKey | ICWVFDHWADMONK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |