About ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate
ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate (PubChem CID 78296016) has the molecular formula C18H29N6O4+
and a molecular weight of 393.47 g/mol. Its IUPAC name is ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
| PubChem CID | 78296016 |
| Molecular Formula | C18H29N6O4+ |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCC[N+]1=C(CN2CCN(C(=O)OCC)CC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H29N6O4/c1-5-7-24-13(12-22-8-10-23(11-9-22)18(27)28-6-2)19-15-14(24)16(25)21(4)17(26)20(15)3/h14H,5-12H2,1-4H3/q+1 |
| InChIKey | XZYXCJNWUHRVFL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate?
The IUPAC name of ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate (CID 78296016) is ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate.
What is the SMILES notation for ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate?
The canonical SMILES for ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate is CCC[N+]1=C(CN2CCN(C(=O)OCC)CC2)N=C2C1C(=O)N(C)C(=O)N2C.
What is the InChIKey of ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate?
The InChIKey is XZYXCJNWUHRVFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N6O4/c1-5-7-24-13(12-22-8-10-23(11-9-22)18(27)28-6-2)19-15-14(24)16(25)21(4)17(26)20(15)3/h14H,5-12H2,1-4H3/q+1.
What are the key properties of ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate?
ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate has a molecular weight of 393.47 g/mol, XLogP of -0.11, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1,3-dimethyl-2,6-dioxo-7-propyl-5H-purin-7-ium-8-yl)methyl]piperazine-1-carboxylate is sourced from PubChem (CID 78296016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).