About 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one
6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one (PubChem CID 78296067) has the molecular formula C19H20N2O3S
and a molecular weight of 356.45 g/mol. Its IUPAC name is 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one.
Molecular Properties
| Compound Name | 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one |
| PubChem CID | 78296067 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one |
| SMILES | Cc1ccc(C(=O)CSC2NC(=O)C(c3ccccc3)C(O)N2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-12-7-9-13(10-8-12)15(22)11-25-19-20-17(23)16(18(24)21-19)14-5-3-2-4-6-14/h2-10,16-17,19-20,23H,11H2,1H3,(H,21,24) |
| InChIKey | RARSFFSBHZIONF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one?
The IUPAC name of 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one (CID 78296067) is 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one.
What is the SMILES notation for 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one?
The canonical SMILES for 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one is Cc1ccc(C(=O)CSC2NC(=O)C(c3ccccc3)C(O)N2)cc1.
What is the InChIKey of 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one?
The InChIKey is RARSFFSBHZIONF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O3S/c1-12-7-9-13(10-8-12)15(22)11-25-19-20-17(23)16(18(24)21-19)14-5-3-2-4-6-14/h2-10,16-17,19-20,23H,11H2,1H3,(H,21,24).
What are the key properties of 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one?
6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one has a molecular weight of 356.45 g/mol, XLogP of 2.02, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanyl-5-phenyl-1,3-diazinan-4-one is sourced from PubChem (CID 78296067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).