C36H50N4O8S2 — CID 78297118
3-[5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea (PubChem CID 78297118) has the molecular formula C36H50N4O8S2 and a molecular weight of 730.95 g/mol. Its IUPAC name is 3-[5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea.
| Compound Name | 3-[5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 78297118 |
| Molecular Formula | C36H50N4O8S2 |
| Molecular Weight | 730.95 g/mol |
| Exact Mass | 730.31 |
| IUPAC Name | 3-[5-[(4-aminophenyl)sulfonyl-(3-methylbutyl)amino]-6-hydroxyhexyl]-1-(1,3-benzodioxol-5-ylmethyl)-1-[(3,4,5-trimethoxyphenyl)methyl]thiourea |
| SMILES | COc1cc(CN(Cc2ccc3c(c2)OCO3)C(=S)NCCCCC(CO)N(CCC(C)C)S(=O)(=O)c2ccc(N)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C36H50N4O8S2/c1-25(2)15-17-40(50(42,43)30-12-10-28(37)11-13-30)29(23-41)8-6-7-16-38-36(49)39(21-26-9-14-31-32(18-26)48-24-47-31)22-27-19-33(44-3)35(46-5)34(20-27)45-4/h9-14,18-20,25,29,41H,6-8,15-17,21-24,37H2,1-5H3,(H,38,49) |
| InChIKey | UHOGCVFVYOSNJA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 145.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|