C21H29N4O+ — CID 7829997
4-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 7829997) has the molecular formula C21H29N4O+ and a molecular weight of 353.49 g/mol. Its IUPAC name is 4-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 7829997 |
| Molecular Formula | C21H29N4O+ |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | 4-[[(1S,9aS)-1,2,3,4,5,6,7,8,9,9a-decahydroquinolizin-5-ium-1-yl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/[C@H]2CCC[NH+]3CCCC[C@@H]23)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H28N4O/c1-16-20(21(26)25(23(16)2)18-10-4-3-5-11-18)22-15-17-9-8-14-24-13-7-6-12-19(17)24/h3-5,10-11,15,17,19H,6-9,12-14H2,1-2H3/p+1/b22-15+/t17-,19+/m1/s1 |
| InChIKey | SEXYFKGWMWZYHK-WWDYBTCKSA-O |
| XLogP | 2.03 |
| TPSA | 43.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|