C15H21N4O4S+ — CID 78301658
butyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate (PubChem CID 78301658) has the molecular formula C15H21N4O4S+ and a molecular weight of 353.42 g/mol. Its IUPAC name is butyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate.
| Compound Name | butyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate |
|---|---|
| PubChem CID | 78301658 |
| Molecular Formula | C15H21N4O4S+ |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | butyl 2-(1-methyl-2,4-dioxo-4a,6,7,8-tetrahydropurino[8,7-b][1,3]thiazin-5-ium-3-yl)acetate |
| SMILES | CCCCOC(=O)CN1C(=O)C2C(=NC3=[N+]2CCCS3)N(C)C1=O |
| InChI | InChI=1S/C15H21N4O4S/c1-3-4-7-23-10(20)9-19-13(21)11-12(17(2)15(19)22)16-14-18(11)6-5-8-24-14/h11H,3-9H2,1-2H3/q+1 |
| InChIKey | QOSVAHNATOTQIM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|