C23H22N2O5 — CID 7830297
2-(1,3-dioxoisoindol-2-yl)ethyl (3S)-1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 7830297) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl (3S)-1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (3S)-1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 7830297 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl (3S)-1-(2,3-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1cccc(N2C[C@@H](C(=O)OCCN3C(=O)c4ccccc4C3=O)CC2=O)c1C |
| InChI | InChI=1S/C23H22N2O5/c1-14-6-5-9-19(15(14)2)25-13-16(12-20(25)26)23(29)30-11-10-24-21(27)17-7-3-4-8-18(17)22(24)28/h3-9,16H,10-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | WQVSAZXCFXGVKY-INIZCTEOSA-N |
| XLogP | 2.50 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|