C9H16N6O4 — CID 78304218
7-(2,3-dihydroxypropyl)-8-hydrazinyl-3-methyl-4,5-dihydropurine-2,6-dione (PubChem CID 78304218) has the molecular formula C9H16N6O4 and a molecular weight of 272.27 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-8-hydrazinyl-3-methyl-4,5-dihydropurine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-8-hydrazinyl-3-methyl-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 78304218 |
| Molecular Formula | C9H16N6O4 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-8-hydrazinyl-3-methyl-4,5-dihydropurine-2,6-dione |
| SMILES | CN1C(=O)NC(=O)C2C1N=C(NN)N2CC(O)CO |
| InChI | InChI=1S/C9H16N6O4/c1-14-6-5(7(18)12-9(14)19)15(2-4(17)3-16)8(11-6)13-10/h4-6,16-17H,2-3,10H2,1H3,(H,11,13)(H,12,18,19) |
| InChIKey | RFZLPQFXJLFFJG-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|