C18H18ClN3OS — CID 7831004
1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-(2-methoxyethyl)thiourea (PubChem CID 7831004) has the molecular formula C18H18ClN3OS and a molecular weight of 359.88 g/mol. Its IUPAC name is 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 7831004 |
| Molecular Formula | C18H18ClN3OS |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 1-[3-chloro-4-[(R)-cyano(phenyl)methyl]phenyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1ccc([C@H](C#N)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClN3OS/c1-23-10-9-21-18(24)22-14-7-8-15(17(19)11-14)16(12-20)13-5-3-2-4-6-13/h2-8,11,16H,9-10H2,1H3,(H2,21,22,24)/t16-/m1/s1 |
| InChIKey | MCQAZCVZKDTTFM-MRXNPFEDSA-N |
| XLogP | 3.93 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|