C21H32N4O3 — CID 78312940
N-[3-(diethylamino)propyl]-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide (PubChem CID 78312940) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide.
| Compound Name | N-[3-(diethylamino)propyl]-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 78312940 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
| SMILES | CCCCCN1C(=O)N=C2C=C(C(=O)NCCCN(CC)CC)C=CC2C1=O |
| InChI | InChI=1S/C21H32N4O3/c1-4-7-8-14-25-20(27)17-11-10-16(15-18(17)23-21(25)28)19(26)22-12-9-13-24(5-2)6-3/h10-11,15,17H,4-9,12-14H2,1-3H3,(H,22,26) |
| InChIKey | NQBOECWDGHGUNJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|