C21H19Cl2N5O3S — CID 78314014
6-[[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione (PubChem CID 78314014) has the molecular formula C21H19Cl2N5O3S and a molecular weight of 492.39 g/mol. Its IUPAC name is 6-[[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 6-[[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78314014 |
| Molecular Formula | C21H19Cl2N5O3S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 491.06 |
| IUPAC Name | 6-[[5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-1,2,4-triazol-3-yl]methyl]-1,3-diazinane-2,4-dione |
| SMILES | COc1ccc(-n2c(CC3CC(=O)NC(=O)N3)nnc2SCc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H19Cl2N5O3S/c1-31-16-6-4-15(5-7-16)28-18(9-14-10-19(29)25-20(30)24-14)26-27-21(28)32-11-12-2-3-13(22)8-17(12)23/h2-8,14H,9-11H2,1H3,(H2,24,25,29,30) |
| InChIKey | FDEADSQCQFEYAU-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |