C15H14ClFN6S2 — CID 78318763
5-[(4aR,7aR)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-3-carbonitrile;hydrochloride (PubChem CID 78318763) has the molecular formula C15H14ClFN6S2 and a molecular weight of 396.90 g/mol. Its IUPAC name is 5-[(4aR,7aR)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-3-carbonitrile;hydrochloride.
| Compound Name | 5-[(4aR,7aR)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-3-carbonitrile;hydrochloride |
|---|---|
| PubChem CID | 78318763 |
| Molecular Formula | C15H14ClFN6S2 |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 5-[(4aR,7aR)-2-amino-6-(5-fluoropyrimidin-2-yl)-4,4a,5,7-tetrahydropyrrolo[3,4-d][1,3]thiazin-7a-yl]thiophene-3-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1csc([C@]23CN(c4ncc(F)cn4)C[C@H]2CSC(N)=N3)c1 |
| InChI | InChI=1S/C15H13FN6S2.ClH/c16-11-3-19-14(20-4-11)22-5-10-7-24-13(18)21-15(10,8-22)12-1-9(2-17)6-23-12;/h1,3-4,6,10H,5,7-8H2,(H2,18,21);1H/t10-,15-;/m0./s1 |
| InChIKey | RLFVKAWDGMVHRR-UQZWWXTDSA-N |
| XLogP | 2.36 |
| TPSA | 91.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |