C24H25F2N3O7S — CID 78318769
(3R,3aR,6R,6aR)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-methylsulfonyl-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 78318769) has the molecular formula C24H25F2N3O7S and a molecular weight of 537.54 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-methylsulfonyl-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-methylsulfonyl-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 78318769 |
| Molecular Formula | C24H25F2N3O7S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[5-(2,6-difluoro-4-morpholin-4-ylphenyl)-3-methylsulfonyl-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CS(=O)(=O)c1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)[nH]c2ccc(-c3c(F)cc(N4CCOCC4)cc3F)nc12 |
| InChI | InChI=1S/C24H25F2N3O7S/c1-37(31,32)23-20-16(28-24(23)36-18-11-35-21-17(30)10-34-22(18)21)3-2-15(27-20)19-13(25)8-12(9-14(19)26)29-4-6-33-7-5-29/h2-3,8-9,17-18,21-22,28,30H,4-7,10-11H2,1H3/t17-,18-,21-,22-/m1/s1 |
| InChIKey | CDZJPHAWELSPJL-MCEIDBOGSA-N |
| XLogP | 1.65 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |