C15H13Cl2N5 — CID 78318959
3-N-benzyl-5-N-(3,5-dichlorophenyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 78318959) has the molecular formula C15H13Cl2N5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 3-N-benzyl-5-N-(3,5-dichlorophenyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-benzyl-5-N-(3,5-dichlorophenyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 78318959 |
| Molecular Formula | C15H13Cl2N5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 3-N-benzyl-5-N-(3,5-dichlorophenyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Clc1cc(Cl)cc(Nc2nc(NCc3ccccc3)n[nH]2)c1 |
| InChI | InChI=1S/C15H13Cl2N5/c16-11-6-12(17)8-13(7-11)19-15-20-14(21-22-15)18-9-10-4-2-1-3-5-10/h1-8H,9H2,(H3,18,19,20,21,22) |
| InChIKey | PXGMXFAAALPZFN-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |