C19H26ClN5O — CID 78318992
3-chloro-5-[5-[1-(oxetan-3-yl)piperidin-4-yl]-1-propan-2-ylpyrazol-3-yl]pyridin-2-amine (PubChem CID 78318992) has the molecular formula C19H26ClN5O and a molecular weight of 375.90 g/mol. Its IUPAC name is 3-chloro-5-[5-[1-(oxetan-3-yl)piperidin-4-yl]-1-propan-2-ylpyrazol-3-yl]pyridin-2-amine.
| Compound Name | 3-chloro-5-[5-[1-(oxetan-3-yl)piperidin-4-yl]-1-propan-2-ylpyrazol-3-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 78318992 |
| Molecular Formula | C19H26ClN5O |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | 3-chloro-5-[5-[1-(oxetan-3-yl)piperidin-4-yl]-1-propan-2-ylpyrazol-3-yl]pyridin-2-amine |
| SMILES | CC(C)n1nc(-c2cnc(N)c(Cl)c2)cc1C1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C19H26ClN5O/c1-12(2)25-18(13-3-5-24(6-4-13)15-10-26-11-15)8-17(23-25)14-7-16(20)19(21)22-9-14/h7-9,12-13,15H,3-6,10-11H2,1-2H3,(H2,21,22) |
| InChIKey | NUWMYJNYJQLGCV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |