About (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone
(7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (PubChem CID 78319262) has the molecular formula C25H20N2O4
and a molecular weight of 412.45 g/mol. Its IUPAC name is (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
Molecular Properties
| Compound Name | (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| PubChem CID | 78319262 |
| Molecular Formula | C25H20N2O4 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone |
| SMILES | O=C(c1ncc(-c2ccccn2)o1)C1COc2cc(OCc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C25H20N2O4/c28-24(25-27-14-23(31-25)21-8-4-5-11-26-21)19-12-18-9-10-20(13-22(18)30-16-19)29-15-17-6-2-1-3-7-17/h1-11,13-14,19H,12,15-16H2 |
| InChIKey | LKKWQRMAYIEENV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The IUPAC name of (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone (CID 78319262) is (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone.
What is the SMILES notation for (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The canonical SMILES for (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is O=C(c1ncc(-c2ccccn2)o1)C1COc2cc(OCc3ccccc3)ccc2C1.
What is the InChIKey of (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
The InChIKey is LKKWQRMAYIEENV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20N2O4/c28-24(25-27-14-23(31-25)21-8-4-5-11-26-21)19-12-18-9-10-20(13-22(18)30-16-19)29-15-17-6-2-1-3-7-17/h1-11,13-14,19H,12,15-16H2.
What are the key properties of (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone?
(7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone has a molecular weight of 412.45 g/mol, XLogP of 4.75, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7-phenylmethoxy-3,4-dihydro-2H-chromen-3-yl)-(5-pyridin-2-yl-1,3-oxazol-2-yl)methanone is sourced from PubChem (CID 78319262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).