C24H18F3N3O5S — CID 78319560
N-(3-sulfamoylphenyl)-2-[4-(2,2,2-trifluoroethoxy)phenoxy]quinoline-3-carboxamide (PubChem CID 78319560) has the molecular formula C24H18F3N3O5S and a molecular weight of 517.49 g/mol. Its IUPAC name is N-(3-sulfamoylphenyl)-2-[4-(2,2,2-trifluoroethoxy)phenoxy]quinoline-3-carboxamide.
| Compound Name | N-(3-sulfamoylphenyl)-2-[4-(2,2,2-trifluoroethoxy)phenoxy]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 78319560 |
| Molecular Formula | C24H18F3N3O5S |
| Molecular Weight | 517.49 g/mol |
| Exact Mass | 517.09 |
| IUPAC Name | N-(3-sulfamoylphenyl)-2-[4-(2,2,2-trifluoroethoxy)phenoxy]quinoline-3-carboxamide |
| SMILES | NS(=O)(=O)c1cccc(NC(=O)c2cc3ccccc3nc2Oc2ccc(OCC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H18F3N3O5S/c25-24(26,27)14-34-17-8-10-18(11-9-17)35-23-20(12-15-4-1-2-7-21(15)30-23)22(31)29-16-5-3-6-19(13-16)36(28,32)33/h1-13H,14H2,(H,29,31)(H2,28,32,33) |
| InChIKey | YMJFOCACXKLBRK-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 120.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.49 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |